C27H37N3O2 — CID 55828595
1-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 55828595) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55828595 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 1-[2-(3,5-dimethylanilino)-2-oxo-1-phenylethyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(C(=O)Nc2cc(C)cc(C)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H37N3O2/c1-4-5-9-14-28-26(31)23-12-15-30(16-13-23)25(22-10-7-6-8-11-22)27(32)29-24-18-20(2)17-21(3)19-24/h6-8,10-11,17-19,23,25H,4-5,9,12-16H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | WTOQVNMUPBAWTJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|