C23H28N2O4 — CID 55828983
(3-carbamoylphenyl) 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 55828983) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (3-carbamoylphenyl) 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | (3-carbamoylphenyl) 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55828983 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (3-carbamoylphenyl) 1-(adamantane-1-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | NC(=O)c1cccc(OC(=O)C2CCCN2C(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H28N2O4/c24-20(26)17-3-1-4-18(10-17)29-21(27)19-5-2-6-25(19)22(28)23-11-14-7-15(12-23)9-16(8-14)13-23/h1,3-4,10,14-16,19H,2,5-9,11-13H2,(H2,24,26) |
| InChIKey | IQVXKKRQUCYUMV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|