C22H25Cl3N4O3 — CID 55828998
4,5-dichloro-2-[3-chloro-4-[4-(2,6-dimethylmorpholine-4-carbonyl)piperidin-1-yl]phenyl]pyridazin-3-one (PubChem CID 55828998) has the molecular formula C22H25Cl3N4O3 and a molecular weight of 499.83 g/mol. Its IUPAC name is 4,5-dichloro-2-[3-chloro-4-[4-(2,6-dimethylmorpholine-4-carbonyl)piperidin-1-yl]phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[3-chloro-4-[4-(2,6-dimethylmorpholine-4-carbonyl)piperidin-1-yl]phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 55828998 |
| Molecular Formula | C22H25Cl3N4O3 |
| Molecular Weight | 499.83 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 4,5-dichloro-2-[3-chloro-4-[4-(2,6-dimethylmorpholine-4-carbonyl)piperidin-1-yl]phenyl]pyridazin-3-one |
| SMILES | CC1CN(C(=O)C2CCN(c3ccc(-n4ncc(Cl)c(Cl)c4=O)cc3Cl)CC2)CC(C)O1 |
| InChI | InChI=1S/C22H25Cl3N4O3/c1-13-11-28(12-14(2)32-13)21(30)15-5-7-27(8-6-15)19-4-3-16(9-17(19)23)29-22(31)20(25)18(24)10-26-29/h3-4,9-10,13-15H,5-8,11-12H2,1-2H3 |
| InChIKey | TUGKRFKCPLCQDI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|