C19H20O5 — CID 558305
(2,2-dimethyl-6-oxo-3,6a-dihydropyrano[3,2-f]chromen-3-yl) 3-methylbut-2-enoate (PubChem CID 558305) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is (2,2-dimethyl-6-oxo-3,6a-dihydropyrano[3,2-f]chromen-3-yl) 3-methylbut-2-enoate.
| Compound Name | (2,2-dimethyl-6-oxo-3,6a-dihydropyrano[3,2-f]chromen-3-yl) 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 558305 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2,2-dimethyl-6-oxo-3,6a-dihydropyrano[3,2-f]chromen-3-yl) 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC1OC2=CC(=O)C3OC=CC=C3C2=CC1(C)C |
| InChI | InChI=1S/C19H20O5/c1-11(2)8-16(21)24-18-19(3,4)10-13-12-6-5-7-22-17(12)14(20)9-15(13)23-18/h5-10,17-18H,1-4H3 |
| InChIKey | LIJJJYNZWNNUJK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|