C18H18BrN3O2S — CID 55831026
5-bromo-N-[2-[(4-cyanophenyl)methyl-propylamino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55831026) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is 5-bromo-N-[2-[(4-cyanophenyl)methyl-propylamino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[(4-cyanophenyl)methyl-propylamino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55831026 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 5-bromo-N-[2-[(4-cyanophenyl)methyl-propylamino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CCCN(Cc1ccc(C#N)cc1)C(=O)CNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C18H18BrN3O2S/c1-2-9-22(12-14-5-3-13(10-20)4-6-14)17(23)11-21-18(24)15-7-8-16(19)25-15/h3-8H,2,9,11-12H2,1H3,(H,21,24) |
| InChIKey | RCKCTVCJBOVOPK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |