C14H12BrIN2O2S — CID 55831882
5-bromo-N-[1-(4-iodoanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 55831882) has the molecular formula C14H12BrIN2O2S and a molecular weight of 479.14 g/mol. Its IUPAC name is 5-bromo-N-[1-(4-iodoanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(4-iodoanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55831882 |
| Molecular Formula | C14H12BrIN2O2S |
| Molecular Weight | 479.14 g/mol |
| Exact Mass | 477.88 |
| IUPAC Name | 5-bromo-N-[1-(4-iodoanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(Br)s1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C14H12BrIN2O2S/c1-8(17-14(20)11-6-7-12(15)21-11)13(19)18-10-4-2-9(16)3-5-10/h2-8H,1H3,(H,17,20)(H,18,19) |
| InChIKey | BBLZSRFNVKURPZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.14 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|