C21H24ClNO2S — CID 55832752
2-(2-chlorophenyl)sulfanyl-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one (PubChem CID 55832752) has the molecular formula C21H24ClNO2S and a molecular weight of 389.95 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55832752 |
| Molecular Formula | C21H24ClNO2S |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]propan-1-one |
| SMILES | CC(Sc1ccccc1Cl)C(=O)N1CCC(C(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24ClNO2S/c1-15(26-19-10-6-5-9-18(19)22)21(25)23-13-11-17(12-14-23)20(24)16-7-3-2-4-8-16/h2-10,15,17,20,24H,11-14H2,1H3 |
| InChIKey | SYROROMQSKWOSC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |