C20H20ClN3O3 — CID 55832891
1-(4-chlorophenyl)-N-[3-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55832891) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[3-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55832891 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-(dimethylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)C2CC(=O)N(c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-23(2)20(27)13-4-3-5-16(10-13)22-19(26)14-11-18(25)24(12-14)17-8-6-15(21)7-9-17/h3-10,14H,11-12H2,1-2H3,(H,22,26) |
| InChIKey | ZZTPBZGCEYCIMC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |