About 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole
4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole (PubChem CID 55833250) has the molecular formula C18H21N3O2S2
and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole |
| PubChem CID | 55833250 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole |
| SMILES | Cc1ccc(C)c(-n2ccnc2S(=O)(=O)Cc2csc(C(C)C)n2)c1 |
| InChI | InChI=1S/C18H21N3O2S2/c1-12(2)17-20-15(10-24-17)11-25(22,23)18-19-7-8-21(18)16-9-13(3)5-6-14(16)4/h5-10,12H,11H2,1-4H3 |
| InChIKey | MRBAKEOAMRLDRU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole?
The IUPAC name of 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole (CID 55833250) is 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole.
What is the SMILES notation for 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole?
The canonical SMILES for 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole is Cc1ccc(C)c(-n2ccnc2S(=O)(=O)Cc2csc(C(C)C)n2)c1.
What is the InChIKey of 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole?
The InChIKey is MRBAKEOAMRLDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2S2/c1-12(2)17-20-15(10-24-17)11-25(22,23)18-19-7-8-21(18)16-9-13(3)5-6-14(16)4/h5-10,12H,11H2,1-4H3.
What are the key properties of 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole?
4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole has a molecular weight of 375.52 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfonylmethyl]-2-propan-2-yl-1,3-thiazole is sourced from PubChem (CID 55833250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).