C20H15F2N3O2S — CID 55834013
N-[4-fluoro-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]phenyl]pyridine-2-carboxamide (PubChem CID 55834013) has the molecular formula C20H15F2N3O2S and a molecular weight of 399.42 g/mol. Its IUPAC name is N-[4-fluoro-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]phenyl]pyridine-2-carboxamide.
| Compound Name | N-[4-fluoro-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55834013 |
| Molecular Formula | C20H15F2N3O2S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[4-fluoro-2-[[2-(4-fluorophenyl)sulfanylacetyl]amino]phenyl]pyridine-2-carboxamide |
| SMILES | O=C(CSc1ccc(F)cc1)Nc1cc(F)ccc1NC(=O)c1ccccn1 |
| InChI | InChI=1S/C20H15F2N3O2S/c21-13-4-7-15(8-5-13)28-12-19(26)24-18-11-14(22)6-9-16(18)25-20(27)17-3-1-2-10-23-17/h1-11H,12H2,(H,24,26)(H,25,27) |
| InChIKey | AQJGUEVSZJNUQT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |