C17H19ClN2O5S — CID 55834326
N-[2-(4-chlorophenoxy)ethyl]-4-(methoxysulfamoyl)-N-methylbenzamide (PubChem CID 55834326) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-4-(methoxysulfamoyl)-N-methylbenzamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-4-(methoxysulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 55834326 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-4-(methoxysulfamoyl)-N-methylbenzamide |
| SMILES | CONS(=O)(=O)c1ccc(C(=O)N(C)CCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H19ClN2O5S/c1-20(11-12-25-15-7-5-14(18)6-8-15)17(21)13-3-9-16(10-4-13)26(22,23)19-24-2/h3-10,19H,11-12H2,1-2H3 |
| InChIKey | XPUUIPQXXZIDJR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|