About 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide
4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 55835011) has the molecular formula C17H15BrF2N2O
and a molecular weight of 381.22 g/mol. Its IUPAC name is 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide.
Molecular Properties
| Compound Name | 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide |
| PubChem CID | 55835011 |
| Molecular Formula | C17H15BrF2N2O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(N2CCCC2)c(F)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrF2N2O/c18-12-5-3-11(4-6-12)17(23)21-13-9-14(19)16(15(20)10-13)22-7-1-2-8-22/h3-6,9-10H,1-2,7-8H2,(H,21,23) |
| InChIKey | CFUWRCHSCBRRTI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide?
The IUPAC name of 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide (CID 55835011) is 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide.
What is the SMILES notation for 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide?
The canonical SMILES for 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide is O=C(Nc1cc(F)c(N2CCCC2)c(F)c1)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide?
The InChIKey is CFUWRCHSCBRRTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15BrF2N2O/c18-12-5-3-11(4-6-12)17(23)21-13-9-14(19)16(15(20)10-13)22-7-1-2-8-22/h3-6,9-10H,1-2,7-8H2,(H,21,23).
What are the key properties of 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide?
4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide has a molecular weight of 381.22 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(3,5-difluoro-4-pyrrolidin-1-ylphenyl)benzamide is sourced from PubChem (CID 55835011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).