C20H19ClN2O5S — CID 55835908
4-[(2-chlorophenyl)methoxy]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-methoxybenzamide (PubChem CID 55835908) has the molecular formula C20H19ClN2O5S and a molecular weight of 434.90 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methoxy]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-methoxybenzamide.
| Compound Name | 4-[(2-chlorophenyl)methoxy]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 55835908 |
| Molecular Formula | C20H19ClN2O5S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 4-[(2-chlorophenyl)methoxy]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCN2C(=O)CSC2=O)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C20H19ClN2O5S/c1-27-17-10-13(19(25)22-8-9-23-18(24)12-29-20(23)26)6-7-16(17)28-11-14-4-2-3-5-15(14)21/h2-7,10H,8-9,11-12H2,1H3,(H,22,25) |
| InChIKey | RYDUVGNBMQDYGB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|