C20H22N4O4 — CID 55836642
N-(2-anilino-2-oxoethyl)-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 55836642) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55836642 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | O=C(CNC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1)Nc1ccccc1 |
| InChI | InChI=1S/C20H22N4O4/c25-19(22-16-6-2-1-3-7-16)14-21-20(26)15-10-12-23(13-11-15)17-8-4-5-9-18(17)24(27)28/h1-9,15H,10-14H2,(H,21,26)(H,22,25) |
| InChIKey | DZOPUWJZCVYEAT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|