C25H20ClN3O4S — CID 55837192
4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]benzamide (PubChem CID 55837192) has the molecular formula C25H20ClN3O4S and a molecular weight of 493.97 g/mol. Its IUPAC name is 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55837192 |
| Molecular Formula | C25H20ClN3O4S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-chloro-3-(2,3-dihydroindol-1-ylsulfonyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]benzamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCc4ccccc43)c2)c1 |
| InChI | InChI=1S/C25H20ClN3O4S/c1-2-17-6-5-8-20(14-17)28-24(30)16-27-25(31)19-10-11-21(26)23(15-19)34(32,33)29-13-12-18-7-3-4-9-22(18)29/h1,3-11,14-15H,12-13,16H2,(H,27,31)(H,28,30) |
| InChIKey | VCXMEKRHGVMRNG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|