C21H26ClN3O3 — CID 55838261
2-(4-chloro-3-methylphenoxy)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]propanamide (PubChem CID 55838261) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]propanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55838261 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]propanamide |
| SMILES | Cc1cc(OC(C)C(=O)NCc2ccc(NC(=O)NC(C)C)cc2)ccc1Cl |
| InChI | InChI=1S/C21H26ClN3O3/c1-13(2)24-21(27)25-17-7-5-16(6-8-17)12-23-20(26)15(4)28-18-9-10-19(22)14(3)11-18/h5-11,13,15H,12H2,1-4H3,(H,23,26)(H2,24,25,27) |
| InChIKey | IRLSHBVZCACDLR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |