C23H30FN3O3S — CID 55838311
1-(4-benzylsulfonylpiperazin-1-yl)-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]ethanone (PubChem CID 55838311) has the molecular formula C23H30FN3O3S and a molecular weight of 447.58 g/mol. Its IUPAC name is 1-(4-benzylsulfonylpiperazin-1-yl)-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]ethanone.
| Compound Name | 1-(4-benzylsulfonylpiperazin-1-yl)-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]ethanone |
|---|---|
| PubChem CID | 55838311 |
| Molecular Formula | C23H30FN3O3S |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-(4-benzylsulfonylpiperazin-1-yl)-2-[ethyl-[1-(4-fluorophenyl)ethyl]amino]ethanone |
| SMILES | CCN(CC(=O)N1CCN(S(=O)(=O)Cc2ccccc2)CC1)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H30FN3O3S/c1-3-25(19(2)21-9-11-22(24)12-10-21)17-23(28)26-13-15-27(16-14-26)31(29,30)18-20-7-5-4-6-8-20/h4-12,19H,3,13-18H2,1-2H3 |
| InChIKey | MEJYOYICNRCWJG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |