C28H30FN3O2 — CID 55838548
N-[(4-fluorophenyl)methyl]-1-[3-oxo-3-(2-phenylanilino)propyl]piperidine-4-carboxamide (PubChem CID 55838548) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-1-[3-oxo-3-(2-phenylanilino)propyl]piperidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-1-[3-oxo-3-(2-phenylanilino)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55838548 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-1-[3-oxo-3-(2-phenylanilino)propyl]piperidine-4-carboxamide |
| SMILES | O=C(CCN1CCC(C(=O)NCc2ccc(F)cc2)CC1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C28H30FN3O2/c29-24-12-10-21(11-13-24)20-30-28(34)23-14-17-32(18-15-23)19-16-27(33)31-26-9-5-4-8-25(26)22-6-2-1-3-7-22/h1-13,23H,14-20H2,(H,30,34)(H,31,33) |
| InChIKey | VCRZYXPSPGBDRV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |