C24H21N3O4 — CID 55840369
3-[4-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenoxy]propanamide (PubChem CID 55840369) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[4-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenoxy]propanamide.
| Compound Name | 3-[4-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenoxy]propanamide |
|---|---|
| PubChem CID | 55840369 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[4-[[2-(9-oxoacridin-10-yl)acetyl]amino]phenoxy]propanamide |
| SMILES | NC(=O)CCOc1ccc(NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H21N3O4/c25-22(28)13-14-31-17-11-9-16(10-12-17)26-23(29)15-27-20-7-3-1-5-18(20)24(30)19-6-2-4-8-21(19)27/h1-12H,13-15H2,(H2,25,28)(H,26,29) |
| InChIKey | GWZGQPOXTGRSTE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|