C25H26N4O4 — CID 55840868
4-methoxy-N-[2-oxo-2-[1-[4-(phenylcarbamoylamino)phenyl]ethylamino]ethyl]benzamide (PubChem CID 55840868) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 4-methoxy-N-[2-oxo-2-[1-[4-(phenylcarbamoylamino)phenyl]ethylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-oxo-2-[1-[4-(phenylcarbamoylamino)phenyl]ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55840868 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 4-methoxy-N-[2-oxo-2-[1-[4-(phenylcarbamoylamino)phenyl]ethylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NC(C)c2ccc(NC(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-17(27-23(30)16-26-24(31)19-10-14-22(33-2)15-11-19)18-8-12-21(13-9-18)29-25(32)28-20-6-4-3-5-7-20/h3-15,17H,16H2,1-2H3,(H,26,31)(H,27,30)(H2,28,29,32) |
| InChIKey | UUNOSIKFVBHONL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |