C16H21N3O4S — CID 55841818
N-(3-benzylsulfonylpropyl)-1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 55841818) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55841818 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | CN1N=C(C(=O)NCCCS(=O)(=O)Cc2ccccc2)CCC1=O |
| InChI | InChI=1S/C16H21N3O4S/c1-19-15(20)9-8-14(18-19)16(21)17-10-5-11-24(22,23)12-13-6-3-2-4-7-13/h2-4,6-7H,5,8-12H2,1H3,(H,17,21) |
| InChIKey | HPKISQIYWOPTOM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|