C24H20FNO4 — CID 55841999
2-benzoyl-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]benzamide (PubChem CID 55841999) has the molecular formula C24H20FNO4 and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-benzoyl-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]benzamide.
| Compound Name | 2-benzoyl-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55841999 |
| Molecular Formula | C24H20FNO4 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-benzoyl-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cc(F)cc2c1OCOC2)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H20FNO4/c25-19-12-17(23-18(13-19)14-29-15-30-23)10-11-26-24(28)21-9-5-4-8-20(21)22(27)16-6-2-1-3-7-16/h1-9,12-13H,10-11,14-15H2,(H,26,28) |
| InChIKey | VEGSEWUMOTXHRH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |