C18H27N5O4 — CID 55842863
N-(tert-butylcarbamoyl)-2-[4-(3-nitrophenyl)piperazin-1-yl]propanamide (PubChem CID 55842863) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-[4-(3-nitrophenyl)piperazin-1-yl]propanamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-[4-(3-nitrophenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 55842863 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-[4-(3-nitrophenyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC(=O)NC(C)(C)C)N1CCN(c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H27N5O4/c1-13(16(24)19-17(25)20-18(2,3)4)21-8-10-22(11-9-21)14-6-5-7-15(12-14)23(26)27/h5-7,12-13H,8-11H2,1-4H3,(H2,19,20,24,25) |
| InChIKey | CHMYEWBYGJWBCQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|