C24H27N3O5S — CID 55844031
4-[(2,5-dimethylphenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide (PubChem CID 55844031) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide.
| Compound Name | 4-[(2,5-dimethylphenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55844031 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)sulfonylamino]-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide |
| SMILES | COCCOc1ccc(CNC(=O)c2ccc(NS(=O)(=O)c3cc(C)ccc3C)cc2)cn1 |
| InChI | InChI=1S/C24H27N3O5S/c1-17-4-5-18(2)22(14-17)33(29,30)27-21-9-7-20(8-10-21)24(28)26-16-19-6-11-23(25-15-19)32-13-12-31-3/h4-11,14-15,27H,12-13,16H2,1-3H3,(H,26,28) |
| InChIKey | LGSXBTXEPIHPFW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|