C27H36N2O5 — CID 55844203
[3-ethoxy-4-(2-phenoxyethoxy)phenyl]-[4-(morpholin-4-ylmethyl)piperidin-1-yl]methanone (PubChem CID 55844203) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is [3-ethoxy-4-(2-phenoxyethoxy)phenyl]-[4-(morpholin-4-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | [3-ethoxy-4-(2-phenoxyethoxy)phenyl]-[4-(morpholin-4-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 55844203 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | [3-ethoxy-4-(2-phenoxyethoxy)phenyl]-[4-(morpholin-4-ylmethyl)piperidin-1-yl]methanone |
| SMILES | CCOc1cc(C(=O)N2CCC(CN3CCOCC3)CC2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C27H36N2O5/c1-2-32-26-20-23(8-9-25(26)34-19-18-33-24-6-4-3-5-7-24)27(30)29-12-10-22(11-13-29)21-28-14-16-31-17-15-28/h3-9,20,22H,2,10-19,21H2,1H3 |
| InChIKey | MEAVXQUFXCIDMZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|