C22H35N3O4 — CID 55844696
ethyl N-[1-[2-[[2-(1-adamantyl)acetyl]amino]acetyl]piperidin-3-yl]carbamate (PubChem CID 55844696) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is ethyl N-[1-[2-[[2-(1-adamantyl)acetyl]amino]acetyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-[2-[[2-(1-adamantyl)acetyl]amino]acetyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 55844696 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | ethyl N-[1-[2-[[2-(1-adamantyl)acetyl]amino]acetyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(C(=O)CNC(=O)CC23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C22H35N3O4/c1-2-29-21(28)24-18-4-3-5-25(14-18)20(27)13-23-19(26)12-22-9-15-6-16(10-22)8-17(7-15)11-22/h15-18H,2-14H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | UCEDGEOSUJXNJN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |