C23H29N5O3 — CID 55844840
5,7-dimethyl-6-[3-oxo-3-[(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)amino]propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 55844840) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 5,7-dimethyl-6-[3-oxo-3-[(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)amino]propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5,7-dimethyl-6-[3-oxo-3-[(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)amino]propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 55844840 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 5,7-dimethyl-6-[3-oxo-3-[(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)amino]propyl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc2c(o1)CC(C)(C)CC2NC(=O)CCc1c(C)nc2c(C(N)=O)cnn2c1C |
| InChI | InChI=1S/C23H29N5O3/c1-12-8-16-18(9-23(4,5)10-19(16)31-12)27-20(29)7-6-15-13(2)26-22-17(21(24)30)11-25-28(22)14(15)3/h8,11,18H,6-7,9-10H2,1-5H3,(H2,24,30)(H,27,29) |
| InChIKey | VZARXLYMDFLGIW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |