C23H27N5O3S — CID 55845938
N-[2-[[2-[[4-ethyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-4-methoxybenzamide (PubChem CID 55845938) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[2-[[2-[[4-ethyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[[2-[[4-ethyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55845938 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[2-[[2-[[4-ethyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-4-methoxybenzamide |
| SMILES | CCn1c(SCC(=O)NCCNC(=O)c2ccc(OC)cc2)nnc1-c1ccccc1C |
| InChI | InChI=1S/C23H27N5O3S/c1-4-28-21(19-8-6-5-7-16(19)2)26-27-23(28)32-15-20(29)24-13-14-25-22(30)17-9-11-18(31-3)12-10-17/h5-12H,4,13-15H2,1-3H3,(H,24,29)(H,25,30) |
| InChIKey | JGASPLBPFGIHPC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|