C23H28N8OS — CID 55846814
3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-5-[3-(1-phenyltetrazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 55846814) has the molecular formula C23H28N8OS and a molecular weight of 464.60 g/mol. Its IUPAC name is 3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-5-[3-(1-phenyltetrazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-5-[3-(1-phenyltetrazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 55846814 |
| Molecular Formula | C23H28N8OS |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-5-[3-(1-phenyltetrazol-5-yl)propylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Cc1ccc(C(C)C)c(OCc2nnc(SCCCc3nnnn3-c3ccccc3)n2N)c1 |
| InChI | InChI=1S/C23H28N8OS/c1-16(2)19-12-11-17(3)14-20(19)32-15-22-25-27-23(30(22)24)33-13-7-10-21-26-28-29-31(21)18-8-5-4-6-9-18/h4-6,8-9,11-12,14,16H,7,10,13,15,24H2,1-3H3 |
| InChIKey | KWNRGJSQOXONQF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|