C23H26N6O3 — CID 55846970
5-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 55846970) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 5-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 5-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55846970 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 5-methyl-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]-1-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(CN3CCC(C)CC3)cc2)nnn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26N6O3/c1-16-10-12-27(13-11-16)15-18-6-8-19(9-7-18)24-23(30)22-17(2)28(26-25-22)20-4-3-5-21(14-20)29(31)32/h3-9,14,16H,10-13,15H2,1-2H3,(H,24,30) |
| InChIKey | LZKLIFKECBVUQB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|