C20H24O2 — CID 558480
2-tert-butyl-2-methyl-4,5-diphenyl-1,3-dioxolane (PubChem CID 558480) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-tert-butyl-2-methyl-4,5-diphenyl-1,3-dioxolane.
| Compound Name | 2-tert-butyl-2-methyl-4,5-diphenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 558480 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-tert-butyl-2-methyl-4,5-diphenyl-1,3-dioxolane |
| SMILES | CC(C)(C)C1(C)OC(c2ccccc2)C(c2ccccc2)O1 |
| InChI | InChI=1S/C20H24O2/c1-19(2,3)20(4)21-17(15-11-7-5-8-12-15)18(22-20)16-13-9-6-10-14-16/h5-14,17-18H,1-4H3 |
| InChIKey | MZBKMCHOGMNZHT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |