C24H27N5O5 — CID 55848096
2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]acetamide (PubChem CID 55848096) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 55848096 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[1-(pyridine-4-carbonyl)piperidin-4-yl]acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)NC3CCN(C(=O)c4ccncc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H27N5O5/c1-24(17-3-5-19(34-2)6-4-17)22(32)29(23(33)27-24)15-20(30)26-18-9-13-28(14-10-18)21(31)16-7-11-25-12-8-16/h3-8,11-12,18H,9-10,13-15H2,1-2H3,(H,26,30)(H,27,33) |
| InChIKey | QOGPZSGRISFMOP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|