C22H26N4O7S — CID 55848575
N-[3-[4-(3-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 55848575) has the molecular formula C22H26N4O7S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-[3-[4-(3-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-[3-[4-(3-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 55848575 |
| Molecular Formula | C22H26N4O7S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[3-[4-(3-nitrophenyl)piperazin-1-yl]-3-oxopropyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)OCCCO2)N1CCN(c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H26N4O7S/c27-22(25-11-9-24(10-12-25)17-3-1-4-18(15-17)26(28)29)7-8-23-34(30,31)19-5-6-20-21(16-19)33-14-2-13-32-20/h1,3-6,15-16,23H,2,7-14H2 |
| InChIKey | UTXIOEZNXYTEMF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|