C24H27FN4O4 — CID 55848705
N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55848705) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55848705 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(CCN2CC(C(=O)NCCNc3cccc(F)c3C#N)CC2=O)cc1OC |
| InChI | InChI=1S/C24H27FN4O4/c1-32-21-7-6-16(12-22(21)33-2)8-11-29-15-17(13-23(29)30)24(31)28-10-9-27-20-5-3-4-19(25)18(20)14-26/h3-7,12,17,27H,8-11,13,15H2,1-2H3,(H,28,31) |
| InChIKey | MNNVXQKOEUPZBM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|