C20H22FN3O4 — CID 55851005
N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-2-oxoethyl]-2-methylfuran-3-carboxamide (PubChem CID 55851005) has the molecular formula C20H22FN3O4 and a molecular weight of 387.41 g/mol. Its IUPAC name is N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-2-oxoethyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-2-oxoethyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 55851005 |
| Molecular Formula | C20H22FN3O4 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-yl]-2-oxoethyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NCC(=O)N1CCN(C(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN3O4/c1-14-17(6-11-28-14)20(27)22-13-19(26)24-9-7-23(8-10-24)18(25)12-15-2-4-16(21)5-3-15/h2-6,11H,7-10,12-13H2,1H3,(H,22,27) |
| InChIKey | CPFVWTRGYXSSHF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |