C24H31N3O4S — CID 55854533
3-(benzylsulfamoyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-4-methylbenzamide (PubChem CID 55854533) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-4-methylbenzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55854533 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-[2-(cyclohexanecarbonylamino)ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C2CCCCC2)cc1S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O4S/c1-18-12-13-21(16-22(18)32(30,31)27-17-19-8-4-2-5-9-19)24(29)26-15-14-25-23(28)20-10-6-3-7-11-20/h2,4-5,8-9,12-13,16,20,27H,3,6-7,10-11,14-15,17H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | OFHNNDZSJWISNR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|