C20H27N3O5S — CID 55854787
N-[2-(cyclohexanecarbonylamino)ethyl]-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carboxamide (PubChem CID 55854787) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[2-(cyclohexanecarbonylamino)ethyl]-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carboxamide.
| Compound Name | N-[2-(cyclohexanecarbonylamino)ethyl]-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 55854787 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[2-(cyclohexanecarbonylamino)ethyl]-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carboxamide |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)NCCNC(=O)C3CCCCC3)cc2S1(=O)=O |
| InChI | InChI=1S/C20H27N3O5S/c1-13(2)23-20(26)16-9-8-15(12-17(16)29(23,27)28)19(25)22-11-10-21-18(24)14-6-4-3-5-7-14/h8-9,12-14H,3-7,10-11H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | PJRIDQDSLLPNLI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|