C14H23N7O3S2 — CID 55856590
2-[[4-amino-5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylacetamide (PubChem CID 55856590) has the molecular formula C14H23N7O3S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 2-[[4-amino-5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylacetamide.
| Compound Name | 2-[[4-amino-5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 55856590 |
| Molecular Formula | C14H23N7O3S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[[4-amino-5-[3-(2,5-dioxoimidazolidin-1-yl)propylsulfanyl]-1,2,4-triazol-3-yl]sulfanyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nnc(SCCCN2C(=O)CNC2=O)n1N |
| InChI | InChI=1S/C14H23N7O3S2/c1-3-19(4-2)11(23)9-26-14-18-17-13(21(14)15)25-7-5-6-20-10(22)8-16-12(20)24/h3-9,15H2,1-2H3,(H,16,24) |
| InChIKey | PSHIRWPUFOCKEH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|