C22H23F2N3O3S — CID 55857915
N-(3-benzylsulfonylpropyl)-1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carboxamide (PubChem CID 55857915) has the molecular formula C22H23F2N3O3S and a molecular weight of 447.51 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55857915 |
| Molecular Formula | C22H23F2N3O3S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-1-(2,4-difluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2F)c(C)c1C(=O)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H23F2N3O3S/c1-15-21(16(2)27(26-15)20-10-9-18(23)13-19(20)24)22(28)25-11-6-12-31(29,30)14-17-7-4-3-5-8-17/h3-5,7-10,13H,6,11-12,14H2,1-2H3,(H,25,28) |
| InChIKey | UHKJANNDTMSCDA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|