About 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide
3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 558586) has the molecular formula C10H15N3OS
and a molecular weight of 225.32 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide |
| PubChem CID | 558586 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCN1CCCC1)Nc1nccs1 |
| InChI | InChI=1S/C10H15N3OS/c14-9(12-10-11-4-8-15-10)3-7-13-5-1-2-6-13/h4,8H,1-3,5-7H2,(H,11,12,14) |
| InChIKey | QLGCZTXGLAPTGD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide?
The IUPAC name of 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide (CID 558586) is 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide.
What is the SMILES notation for 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide?
The canonical SMILES for 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide is O=C(CCN1CCCC1)Nc1nccs1.
What is the InChIKey of 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide?
The InChIKey is QLGCZTXGLAPTGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS/c14-9(12-10-11-4-8-15-10)3-7-13-5-1-2-6-13/h4,8H,1-3,5-7H2,(H,11,12,14).
What are the key properties of 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide?
3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide has a molecular weight of 225.32 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-yl-N-(1,3-thiazol-2-yl)propanamide is sourced from PubChem (CID 558586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).