C22H28N4O2 — CID 55858736
4-(2-methylpropanoylamino)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 55858736) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-(2-methylpropanoylamino)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | 4-(2-methylpropanoylamino)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55858736 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-(2-methylpropanoylamino)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)NC2CCN(Cc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O2/c1-16(2)21(27)24-18-8-6-17(7-9-18)22(28)25-19-10-13-26(14-11-19)15-20-5-3-4-12-23-20/h3-9,12,16,19H,10-11,13-15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | PDHWYDXGGHZYFO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |