C27H26ClN3O3 — CID 55858769
1-[[3-[[2-(4-chlorobenzoyl)benzoyl]amino]phenyl]methyl]piperidine-4-carboxamide (PubChem CID 55858769) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is 1-[[3-[[2-(4-chlorobenzoyl)benzoyl]amino]phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[3-[[2-(4-chlorobenzoyl)benzoyl]amino]phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55858769 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-[[3-[[2-(4-chlorobenzoyl)benzoyl]amino]phenyl]methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(Cc2cccc(NC(=O)c3ccccc3C(=O)c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C27H26ClN3O3/c28-21-10-8-19(9-11-21)25(32)23-6-1-2-7-24(23)27(34)30-22-5-3-4-18(16-22)17-31-14-12-20(13-15-31)26(29)33/h1-11,16,20H,12-15,17H2,(H2,29,33)(H,30,34) |
| InChIKey | MZHJGDPVUUXJRQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |