C19H16Cl2N2O4 — CID 55858815
1,3-benzodioxol-4-yl-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]methanone (PubChem CID 55858815) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is 1,3-benzodioxol-4-yl-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-4-yl-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55858815 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 1,3-benzodioxol-4-yl-[4-(2,3-dichlorobenzoyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1CCN(C(=O)c2cccc3c2OCO3)CC1 |
| InChI | InChI=1S/C19H16Cl2N2O4/c20-14-5-1-3-12(16(14)21)18(24)22-7-9-23(10-8-22)19(25)13-4-2-6-15-17(13)27-11-26-15/h1-6H,7-11H2 |
| InChIKey | HSCAYZJVVSBTPC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |