C17H29N5O4 — CID 55859612
tert-butyl N-[1-oxo-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]carbamate (PubChem CID 55859612) has the molecular formula C17H29N5O4 and a molecular weight of 367.45 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 55859612 |
| Molecular Formula | C17H29N5O4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | tert-butyl N-[1-oxo-1-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]propan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C17H29N5O4/c1-12(19-15(24)26-17(2,3)4)14(23)18-9-7-11-22-16(25)21-10-6-5-8-13(21)20-22/h12H,5-11H2,1-4H3,(H,18,23)(H,19,24) |
| InChIKey | UJSVRQBOTPVDOY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|