C19H12F3N5O2S — CID 55860155
3-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 55860155) has the molecular formula C19H12F3N5O2S and a molecular weight of 431.40 g/mol. Its IUPAC name is 3-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 55860155 |
| Molecular Formula | C19H12F3N5O2S |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 3-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1Cc1nnnn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12F3N5O2S/c20-19(21,22)13-7-9-14(10-8-13)27-17(23-24-25-27)11-26-15-5-1-3-12-4-2-6-16(18(12)15)30(26,28)29/h1-10H,11H2 |
| InChIKey | PCGHMDAQYFPUSE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |