C20H28BrN3O3 — CID 55860378
1-[2-[(3-bromobenzoyl)amino]acetyl]-N-butyl-N-methylpiperidine-4-carboxamide (PubChem CID 55860378) has the molecular formula C20H28BrN3O3 and a molecular weight of 438.37 g/mol. Its IUPAC name is 1-[2-[(3-bromobenzoyl)amino]acetyl]-N-butyl-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(3-bromobenzoyl)amino]acetyl]-N-butyl-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55860378 |
| Molecular Formula | C20H28BrN3O3 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 1-[2-[(3-bromobenzoyl)amino]acetyl]-N-butyl-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)CNC(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C20H28BrN3O3/c1-3-4-10-23(2)20(27)15-8-11-24(12-9-15)18(25)14-22-19(26)16-6-5-7-17(21)13-16/h5-7,13,15H,3-4,8-12,14H2,1-2H3,(H,22,26) |
| InChIKey | UAZKLUZUFDHWMR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |