C22H34N4O5 — CID 55860589
tert-butyl N-[1-[[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 55860589) has the molecular formula C22H34N4O5 and a molecular weight of 434.54 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55860589 |
| Molecular Formula | C22H34N4O5 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | tert-butyl N-[1-[[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CN2C(=O)C(=O)N(CCC3=CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C22H34N4O5/c1-22(2,3)31-20(29)23-17-10-12-24(13-11-17)15-26-19(28)18(27)25(21(26)30)14-9-16-7-5-4-6-8-16/h7,17H,4-6,8-15H2,1-3H3,(H,23,29) |
| InChIKey | MKOLDNBPZXRNFN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|