C25H32N6S — CID 55860966
4-(4-methylphenyl)-2-[(4-methyl-2-phenylpiperazin-1-yl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazole-3-thione (PubChem CID 55860966) has the molecular formula C25H32N6S and a molecular weight of 448.64 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-[(4-methyl-2-phenylpiperazin-1-yl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-(4-methylphenyl)-2-[(4-methyl-2-phenylpiperazin-1-yl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55860966 |
| Molecular Formula | C25H32N6S |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4-(4-methylphenyl)-2-[(4-methyl-2-phenylpiperazin-1-yl)methyl]-5-pyrrolidin-1-yl-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-n2c(N3CCCC3)nn(CN3CCN(C)CC3c3ccccc3)c2=S)cc1 |
| InChI | InChI=1S/C25H32N6S/c1-20-10-12-22(13-11-20)31-24(28-14-6-7-15-28)26-30(25(31)32)19-29-17-16-27(2)18-23(29)21-8-4-3-5-9-21/h3-5,8-13,23H,6-7,14-19H2,1-2H3 |
| InChIKey | AGXNEJRSDDPDNC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|