C23H28N6OS — CID 55861236
4-cyclopropyl-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 55861236) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55861236 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-cyclopropyl-2-[[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methyl]-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(N2CCCN(Cn3nc(-c4cccnc4)n(C4CC4)c3=S)CC2)cc1 |
| InChI | InChI=1S/C23H28N6OS/c1-30-21-9-7-19(8-10-21)27-13-3-12-26(14-15-27)17-28-23(31)29(20-5-6-20)22(25-28)18-4-2-11-24-16-18/h2,4,7-11,16,20H,3,5-6,12-15,17H2,1H3 |
| InChIKey | MALFZZZQANKNIG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|