C20H30N6S — CID 55861349
4-cyclopropyl-2-[[4-(3-methylbutyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 55861349) has the molecular formula C20H30N6S and a molecular weight of 386.57 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[4-(3-methylbutyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-2-[[4-(3-methylbutyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55861349 |
| Molecular Formula | C20H30N6S |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 4-cyclopropyl-2-[[4-(3-methylbutyl)piperazin-1-yl]methyl]-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | CC(C)CCN1CCN(Cn2nc(-c3ccncc3)n(C3CC3)c2=S)CC1 |
| InChI | InChI=1S/C20H30N6S/c1-16(2)7-10-23-11-13-24(14-12-23)15-25-20(27)26(18-3-4-18)19(22-25)17-5-8-21-9-6-17/h5-6,8-9,16,18H,3-4,7,10-15H2,1-2H3 |
| InChIKey | KSPPHUZGWPYQDX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|